C10H13FN2O2 — CID 103295990
5-amino-2-fluoro-N-methoxy-N,3-dimethylbenzamide (PubChem CID 103295990) has the molecular formula C10H13FN2O2 and a molecular weight of 212.22 g/mol. Its IUPAC name is 5-amino-2-fluoro-N-methoxy-N,3-dimethylbenzamide.
| Compound Name | 5-amino-2-fluoro-N-methoxy-N,3-dimethylbenzamide |
|---|---|
| PubChem CID | 103295990 |
| Molecular Formula | C10H13FN2O2 |
| Molecular Weight | 212.22 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 5-amino-2-fluoro-N-methoxy-N,3-dimethylbenzamide |
| SMILES | CON(C)C(=O)c1cc(N)cc(C)c1F |
| InChI | InChI=1S/C10H13FN2O2/c1-6-4-7(12)5-8(9(6)11)10(14)13(2)15-3/h4-5H,12H2,1-3H3 |
| InChIKey | QYSHJAQDZAUWIE-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.22 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|