C16H23FN2O — CID 103296058
5-amino-2-fluoro-N,3-dimethyl-N-(4-methylcyclohexyl)benzamide (PubChem CID 103296058) has the molecular formula C16H23FN2O and a molecular weight of 278.37 g/mol. Its IUPAC name is 5-amino-2-fluoro-N,3-dimethyl-N-(4-methylcyclohexyl)benzamide.
| Compound Name | 5-amino-2-fluoro-N,3-dimethyl-N-(4-methylcyclohexyl)benzamide |
|---|---|
| PubChem CID | 103296058 |
| Molecular Formula | C16H23FN2O |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 5-amino-2-fluoro-N,3-dimethyl-N-(4-methylcyclohexyl)benzamide |
| SMILES | Cc1cc(N)cc(C(=O)N(C)C2CCC(C)CC2)c1F |
| InChI | InChI=1S/C16H23FN2O/c1-10-4-6-13(7-5-10)19(3)16(20)14-9-12(18)8-11(2)15(14)17/h8-10,13H,4-7,18H2,1-3H3 |
| InChIKey | KPGWOXCJLLQVHI-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|