C12H14FNO — CID 115745650
N-cyclopropyl-4-fluoro-N,2-dimethylbenzamide (PubChem CID 115745650) has the molecular formula C12H14FNO and a molecular weight of 207.25 g/mol. Its IUPAC name is N-cyclopropyl-4-fluoro-N,2-dimethylbenzamide.
| Compound Name | N-cyclopropyl-4-fluoro-N,2-dimethylbenzamide |
|---|---|
| PubChem CID | 115745650 |
| Molecular Formula | C12H14FNO |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | N-cyclopropyl-4-fluoro-N,2-dimethylbenzamide |
| SMILES | Cc1cc(F)ccc1C(=O)N(C)C1CC1 |
| InChI | InChI=1S/C12H14FNO/c1-8-7-9(13)3-6-11(8)12(15)14(2)10-4-5-10/h3,6-7,10H,4-5H2,1-2H3 |
| InChIKey | GZFGDXBZXOXLRJ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |