C19H27FN2O — CID 134704150
N-[(3aR,6aS)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-4-fluoro-N,2-dimethylbenzamide (PubChem CID 134704150) has the molecular formula C19H27FN2O and a molecular weight of 318.44 g/mol. Its IUPAC name is N-[(3aR,6aS)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-4-fluoro-N,2-dimethylbenzamide.
| Compound Name | N-[(3aR,6aS)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-4-fluoro-N,2-dimethylbenzamide |
|---|---|
| PubChem CID | 134704150 |
| Molecular Formula | C19H27FN2O |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | N-[(3aR,6aS)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-4-fluoro-N,2-dimethylbenzamide |
| SMILES | Cc1cc(F)ccc1C(=O)N(C)C1C[C@H]2CC(N(C)C)C[C@H]2C1 |
| InChI | InChI=1S/C19H27FN2O/c1-12-7-15(20)5-6-18(12)19(23)22(4)17-10-13-8-16(21(2)3)9-14(13)11-17/h5-7,13-14,16-17H,8-11H2,1-4H3/t13-,14+,16?,17? |
| InChIKey | LJUGJKFEYFWQQR-CBHXASLJSA-N |
| XLogP | 3.32 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |