C20H30N2O3 — CID 134705360
N-[(3aR,6aS)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-2,4-dimethoxy-N-methylbenzamide (PubChem CID 134705360) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is N-[(3aR,6aS)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-2,4-dimethoxy-N-methylbenzamide.
| Compound Name | N-[(3aR,6aS)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-2,4-dimethoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 134705360 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | N-[(3aR,6aS)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-2,4-dimethoxy-N-methylbenzamide |
| SMILES | COc1ccc(C(=O)N(C)C2C[C@H]3CC(N(C)C)C[C@H]3C2)c(OC)c1 |
| InChI | InChI=1S/C20H30N2O3/c1-21(2)15-8-13-10-16(11-14(13)9-15)22(3)20(23)18-7-6-17(24-4)12-19(18)25-5/h6-7,12-16H,8-11H2,1-5H3/t13-,14+,15?,16? |
| InChIKey | MPPIULAULJUALR-PJPHBNEVSA-N |
| XLogP | 2.89 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |