C16H22BrNO3 — CID 80652711
N-(2-bromoethyl)-N-cyclopentyl-2,4-dimethoxybenzamide (PubChem CID 80652711) has the molecular formula C16H22BrNO3 and a molecular weight of 356.26 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-cyclopentyl-2,4-dimethoxybenzamide.
| Compound Name | N-(2-bromoethyl)-N-cyclopentyl-2,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 80652711 |
| Molecular Formula | C16H22BrNO3 |
| Molecular Weight | 356.26 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | N-(2-bromoethyl)-N-cyclopentyl-2,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)N(CCBr)C2CCCC2)c(OC)c1 |
| InChI | InChI=1S/C16H22BrNO3/c1-20-13-7-8-14(15(11-13)21-2)16(19)18(10-9-17)12-5-3-4-6-12/h7-8,11-12H,3-6,9-10H2,1-2H3 |
| InChIKey | AKSLSVNMWSCXND-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.26 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|