C14H18BrNO3 — CID 80665946
N-(2-bromoethyl)-N-cyclopropyl-2,5-dimethoxybenzamide (PubChem CID 80665946) has the molecular formula C14H18BrNO3 and a molecular weight of 328.21 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-cyclopropyl-2,5-dimethoxybenzamide.
| Compound Name | N-(2-bromoethyl)-N-cyclopropyl-2,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 80665946 |
| Molecular Formula | C14H18BrNO3 |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | N-(2-bromoethyl)-N-cyclopropyl-2,5-dimethoxybenzamide |
| SMILES | COc1ccc(OC)c(C(=O)N(CCBr)C2CC2)c1 |
| InChI | InChI=1S/C14H18BrNO3/c1-18-11-5-6-13(19-2)12(9-11)14(17)16(8-7-15)10-3-4-10/h5-6,9-10H,3-4,7-8H2,1-2H3 |
| InChIKey | GDNZPTDBXRMGCY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|