C20H30N2O5 — CID 90607312
2,4-dimethoxy-N-(2-morpholin-4-ylethyl)-N-(oxan-4-yl)benzamide (PubChem CID 90607312) has the molecular formula C20H30N2O5 and a molecular weight of 378.47 g/mol. Its IUPAC name is 2,4-dimethoxy-N-(2-morpholin-4-ylethyl)-N-(oxan-4-yl)benzamide.
| Compound Name | 2,4-dimethoxy-N-(2-morpholin-4-ylethyl)-N-(oxan-4-yl)benzamide |
|---|---|
| PubChem CID | 90607312 |
| Molecular Formula | C20H30N2O5 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 2,4-dimethoxy-N-(2-morpholin-4-ylethyl)-N-(oxan-4-yl)benzamide |
| SMILES | COc1ccc(C(=O)N(CCN2CCOCC2)C2CCOCC2)c(OC)c1 |
| InChI | InChI=1S/C20H30N2O5/c1-24-17-3-4-18(19(15-17)25-2)20(23)22(16-5-11-26-12-6-16)8-7-21-9-13-27-14-10-21/h3-4,15-16H,5-14H2,1-2H3 |
| InChIKey | WDNXNIVVLKMMMK-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |