C14H19NO4 — CID 82050526
1-(2,4-dimethoxyphenyl)-2-morpholin-4-ylethanone (PubChem CID 82050526) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-2-morpholin-4-ylethanone.
| Compound Name | 1-(2,4-dimethoxyphenyl)-2-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 82050526 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-2-morpholin-4-ylethanone |
| SMILES | COc1ccc(C(=O)CN2CCOCC2)c(OC)c1 |
| InChI | InChI=1S/C14H19NO4/c1-17-11-3-4-12(14(9-11)18-2)13(16)10-15-5-7-19-8-6-15/h3-4,9H,5-8,10H2,1-2H3 |
| InChIKey | KLZFVXWPTLUZOZ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |