C15H22N2O3 — CID 93191408
1-(2,4-dimethoxyphenyl)-2-(4-methylpiperazin-1-yl)ethanone (PubChem CID 93191408) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-2-(4-methylpiperazin-1-yl)ethanone.
| Compound Name | 1-(2,4-dimethoxyphenyl)-2-(4-methylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 93191408 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-2-(4-methylpiperazin-1-yl)ethanone |
| SMILES | COc1ccc(C(=O)CN2CCN(C)CC2)c(OC)c1 |
| InChI | InChI=1S/C15H22N2O3/c1-16-6-8-17(9-7-16)11-14(18)13-5-4-12(19-2)10-15(13)20-3/h4-5,10H,6-9,11H2,1-3H3 |
| InChIKey | KXVWSROBZRRMRX-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |