C12H15NO3 — CID 94683814
2-(aziridin-1-yl)-1-(2,5-dimethoxyphenyl)ethanone (PubChem CID 94683814) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is 2-(aziridin-1-yl)-1-(2,5-dimethoxyphenyl)ethanone.
| Compound Name | 2-(aziridin-1-yl)-1-(2,5-dimethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 94683814 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 2-(aziridin-1-yl)-1-(2,5-dimethoxyphenyl)ethanone |
| SMILES | COc1ccc(OC)c(C(=O)CN2CC2)c1 |
| InChI | InChI=1S/C12H15NO3/c1-15-9-3-4-12(16-2)10(7-9)11(14)8-13-5-6-13/h3-4,7H,5-6,8H2,1-2H3 |
| InChIKey | KPNPYXSESOXRKZ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 38.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|