C27H28N2O3 — CID 4226165
1-(2,5-dimethoxyphenyl)-2-[4-(9H-fluoren-9-yl)piperazin-1-yl]ethanone (PubChem CID 4226165) has the molecular formula C27H28N2O3 and a molecular weight of 428.53 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-2-[4-(9H-fluoren-9-yl)piperazin-1-yl]ethanone.
| Compound Name | 1-(2,5-dimethoxyphenyl)-2-[4-(9H-fluoren-9-yl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 4226165 |
| Molecular Formula | C27H28N2O3 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-2-[4-(9H-fluoren-9-yl)piperazin-1-yl]ethanone |
| SMILES | COc1ccc(OC)c(C(=O)CN2CCN(C3c4ccccc4-c4ccccc43)CC2)c1 |
| InChI | InChI=1S/C27H28N2O3/c1-31-19-11-12-26(32-2)24(17-19)25(30)18-28-13-15-29(16-14-28)27-22-9-5-3-7-20(22)21-8-4-6-10-23(21)27/h3-12,17,27H,13-16,18H2,1-2H3 |
| InChIKey | NSYVVBPCSULJGQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |