C19H27N3O4 — CID 17471888
2-[4-(2,5-dimethoxybenzoyl)piperazin-1-yl]-1-pyrrolidin-1-ylethanone (PubChem CID 17471888) has the molecular formula C19H27N3O4 and a molecular weight of 361.44 g/mol. Its IUPAC name is 2-[4-(2,5-dimethoxybenzoyl)piperazin-1-yl]-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-[4-(2,5-dimethoxybenzoyl)piperazin-1-yl]-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 17471888 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | 2-[4-(2,5-dimethoxybenzoyl)piperazin-1-yl]-1-pyrrolidin-1-ylethanone |
| SMILES | COc1ccc(OC)c(C(=O)N2CCN(CC(=O)N3CCCC3)CC2)c1 |
| InChI | InChI=1S/C19H27N3O4/c1-25-15-5-6-17(26-2)16(13-15)19(24)22-11-9-20(10-12-22)14-18(23)21-7-3-4-8-21/h5-6,13H,3-4,7-12,14H2,1-2H3 |
| InChIKey | LUOCENMEJJNUAC-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |