C19H29N3O4 — CID 18163262
N-butyl-2-[4-(2,5-dimethoxybenzoyl)piperazin-1-yl]acetamide (PubChem CID 18163262) has the molecular formula C19H29N3O4 and a molecular weight of 363.46 g/mol. Its IUPAC name is N-butyl-2-[4-(2,5-dimethoxybenzoyl)piperazin-1-yl]acetamide.
| Compound Name | N-butyl-2-[4-(2,5-dimethoxybenzoyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 18163262 |
| Molecular Formula | C19H29N3O4 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | N-butyl-2-[4-(2,5-dimethoxybenzoyl)piperazin-1-yl]acetamide |
| SMILES | CCCCNC(=O)CN1CCN(C(=O)c2cc(OC)ccc2OC)CC1 |
| InChI | InChI=1S/C19H29N3O4/c1-4-5-8-20-18(23)14-21-9-11-22(12-10-21)19(24)16-13-15(25-2)6-7-17(16)26-3/h6-7,13H,4-5,8-12,14H2,1-3H3,(H,20,23) |
| InChIKey | TUAQCJFCRIGVIX-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|