C18H27N3O4 — CID 110813383
4-(2,5-dimethoxybenzoyl)-N-propyl-1,4-diazepane-1-carboxamide (PubChem CID 110813383) has the molecular formula C18H27N3O4 and a molecular weight of 349.43 g/mol. Its IUPAC name is 4-(2,5-dimethoxybenzoyl)-N-propyl-1,4-diazepane-1-carboxamide.
| Compound Name | 4-(2,5-dimethoxybenzoyl)-N-propyl-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 110813383 |
| Molecular Formula | C18H27N3O4 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | 4-(2,5-dimethoxybenzoyl)-N-propyl-1,4-diazepane-1-carboxamide |
| SMILES | CCCNC(=O)N1CCCN(C(=O)c2cc(OC)ccc2OC)CC1 |
| InChI | InChI=1S/C18H27N3O4/c1-4-8-19-18(23)21-10-5-9-20(11-12-21)17(22)15-13-14(24-2)6-7-16(15)25-3/h6-7,13H,4-5,8-12H2,1-3H3,(H,19,23) |
| InChIKey | MWOWZHMBGLGQFJ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |