C17H25N3O4 — CID 110365697
4-(3,5-dimethoxybenzoyl)-N-propylpiperazine-1-carboxamide (PubChem CID 110365697) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is 4-(3,5-dimethoxybenzoyl)-N-propylpiperazine-1-carboxamide.
| Compound Name | 4-(3,5-dimethoxybenzoyl)-N-propylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 110365697 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 4-(3,5-dimethoxybenzoyl)-N-propylpiperazine-1-carboxamide |
| SMILES | CCCNC(=O)N1CCN(C(=O)c2cc(OC)cc(OC)c2)CC1 |
| InChI | InChI=1S/C17H25N3O4/c1-4-5-18-17(22)20-8-6-19(7-9-20)16(21)13-10-14(23-2)12-15(11-13)24-3/h10-12H,4-9H2,1-3H3,(H,18,22) |
| InChIKey | QFYAHIFZMYNOOO-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |