C19H29N3O4 — CID 119507447
1-(3,5-dimethoxybenzoyl)-N-[2-(ethylamino)ethyl]piperidine-4-carboxamide (PubChem CID 119507447) has the molecular formula C19H29N3O4 and a molecular weight of 363.46 g/mol. Its IUPAC name is 1-(3,5-dimethoxybenzoyl)-N-[2-(ethylamino)ethyl]piperidine-4-carboxamide.
| Compound Name | 1-(3,5-dimethoxybenzoyl)-N-[2-(ethylamino)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 119507447 |
| Molecular Formula | C19H29N3O4 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | 1-(3,5-dimethoxybenzoyl)-N-[2-(ethylamino)ethyl]piperidine-4-carboxamide |
| SMILES | CCNCCNC(=O)C1CCN(C(=O)c2cc(OC)cc(OC)c2)CC1 |
| InChI | InChI=1S/C19H29N3O4/c1-4-20-7-8-21-18(23)14-5-9-22(10-6-14)19(24)15-11-16(25-2)13-17(12-15)26-3/h11-14,20H,4-10H2,1-3H3,(H,21,23) |
| InChIKey | ISSZBFZQLBOVRO-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|