C22H24Cl2N2O4 — CID 126060422
N-[(2,4-dichlorophenyl)methyl]-1-(3,5-dimethoxybenzoyl)piperidine-4-carboxamide (PubChem CID 126060422) has the molecular formula C22H24Cl2N2O4 and a molecular weight of 451.35 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methyl]-1-(3,5-dimethoxybenzoyl)piperidine-4-carboxamide.
| Compound Name | N-[(2,4-dichlorophenyl)methyl]-1-(3,5-dimethoxybenzoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 126060422 |
| Molecular Formula | C22H24Cl2N2O4 |
| Molecular Weight | 451.35 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methyl]-1-(3,5-dimethoxybenzoyl)piperidine-4-carboxamide |
| SMILES | COc1cc(OC)cc(C(=O)N2CCC(C(=O)NCc3ccc(Cl)cc3Cl)CC2)c1 |
| InChI | InChI=1S/C22H24Cl2N2O4/c1-29-18-9-16(10-19(12-18)30-2)22(28)26-7-5-14(6-8-26)21(27)25-13-15-3-4-17(23)11-20(15)24/h3-4,9-12,14H,5-8,13H2,1-2H3,(H,25,27) |
| InChIKey | PTACAGXHVNQJJZ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.35 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |