C20H19BrCl2N2O2 — CID 1004020
1-(4-bromobenzoyl)-N-[(2,4-dichlorophenyl)methyl]piperidine-4-carboxamide (PubChem CID 1004020) has the molecular formula C20H19BrCl2N2O2 and a molecular weight of 470.19 g/mol. Its IUPAC name is 1-(4-bromobenzoyl)-N-[(2,4-dichlorophenyl)methyl]piperidine-4-carboxamide.
| Compound Name | 1-(4-bromobenzoyl)-N-[(2,4-dichlorophenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 1004020 |
| Molecular Formula | C20H19BrCl2N2O2 |
| Molecular Weight | 470.19 g/mol |
| Exact Mass | 468.00 |
| IUPAC Name | 1-(4-bromobenzoyl)-N-[(2,4-dichlorophenyl)methyl]piperidine-4-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)cc1Cl)C1CCN(C(=O)c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C20H19BrCl2N2O2/c21-16-4-1-14(2-5-16)20(27)25-9-7-13(8-10-25)19(26)24-12-15-3-6-17(22)11-18(15)23/h1-6,11,13H,7-10,12H2,(H,24,26) |
| InChIKey | SLMBZGFWANANNT-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.19 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |