C19H20Cl2N2O2 — CID 170861732
1-[2-chloro-4-(4-chlorophenoxy)phenyl]-2-(4-methylpiperazin-1-yl)ethanone (PubChem CID 170861732) has the molecular formula C19H20Cl2N2O2 and a molecular weight of 379.29 g/mol. Its IUPAC name is 1-[2-chloro-4-(4-chlorophenoxy)phenyl]-2-(4-methylpiperazin-1-yl)ethanone.
| Compound Name | 1-[2-chloro-4-(4-chlorophenoxy)phenyl]-2-(4-methylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 170861732 |
| Molecular Formula | C19H20Cl2N2O2 |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 1-[2-chloro-4-(4-chlorophenoxy)phenyl]-2-(4-methylpiperazin-1-yl)ethanone |
| SMILES | CN1CCN(CC(=O)c2ccc(Oc3ccc(Cl)cc3)cc2Cl)CC1 |
| InChI | InChI=1S/C19H20Cl2N2O2/c1-22-8-10-23(11-9-22)13-19(24)17-7-6-16(12-18(17)21)25-15-4-2-14(20)3-5-15/h2-7,12H,8-11,13H2,1H3 |
| InChIKey | IHPJTOXBSXGXCI-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |