C17H26N4O4 — CID 90607257
1-methyl-N-(2-morpholin-4-ylethyl)-N-(oxan-4-yl)-6-oxopyridazine-3-carboxamide (PubChem CID 90607257) has the molecular formula C17H26N4O4 and a molecular weight of 350.42 g/mol. Its IUPAC name is 1-methyl-N-(2-morpholin-4-ylethyl)-N-(oxan-4-yl)-6-oxopyridazine-3-carboxamide.
| Compound Name | 1-methyl-N-(2-morpholin-4-ylethyl)-N-(oxan-4-yl)-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 90607257 |
| Molecular Formula | C17H26N4O4 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 1-methyl-N-(2-morpholin-4-ylethyl)-N-(oxan-4-yl)-6-oxopyridazine-3-carboxamide |
| SMILES | Cn1nc(C(=O)N(CCN2CCOCC2)C2CCOCC2)ccc1=O |
| InChI | InChI=1S/C17H26N4O4/c1-19-16(22)3-2-15(18-19)17(23)21(14-4-10-24-11-5-14)7-6-20-8-12-25-13-9-20/h2-3,14H,4-13H2,1H3 |
| InChIKey | ODWISTZOYYWHBE-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 76.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |