C12H15N3O5 — CID 66238377
4-[methyl-(1-methyl-6-oxopyridazine-3-carbonyl)amino]oxolane-3-carboxylic acid (PubChem CID 66238377) has the molecular formula C12H15N3O5 and a molecular weight of 281.27 g/mol. Its IUPAC name is 4-[methyl-(1-methyl-6-oxopyridazine-3-carbonyl)amino]oxolane-3-carboxylic acid.
| Compound Name | 4-[methyl-(1-methyl-6-oxopyridazine-3-carbonyl)amino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 66238377 |
| Molecular Formula | C12H15N3O5 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 4-[methyl-(1-methyl-6-oxopyridazine-3-carbonyl)amino]oxolane-3-carboxylic acid |
| SMILES | CN(C(=O)c1ccc(=O)n(C)n1)C1COCC1C(=O)O |
| InChI | InChI=1S/C12H15N3O5/c1-14(9-6-20-5-7(9)12(18)19)11(17)8-3-4-10(16)15(2)13-8/h3-4,7,9H,5-6H2,1-2H3,(H,18,19) |
| InChIKey | LHVVVRYPBKSBTF-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |