C11H12BrNO5 — CID 106851090
4-[(2-bromofuran-3-carbonyl)-methylamino]oxolane-3-carboxylic acid (PubChem CID 106851090) has the molecular formula C11H12BrNO5 and a molecular weight of 318.12 g/mol. Its IUPAC name is 4-[(2-bromofuran-3-carbonyl)-methylamino]oxolane-3-carboxylic acid.
| Compound Name | 4-[(2-bromofuran-3-carbonyl)-methylamino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 106851090 |
| Molecular Formula | C11H12BrNO5 |
| Molecular Weight | 318.12 g/mol |
| Exact Mass | 316.99 |
| IUPAC Name | 4-[(2-bromofuran-3-carbonyl)-methylamino]oxolane-3-carboxylic acid |
| SMILES | CN(C(=O)c1ccoc1Br)C1COCC1C(=O)O |
| InChI | InChI=1S/C11H12BrNO5/c1-13(8-5-17-4-7(8)11(15)16)10(14)6-2-3-18-9(6)12/h2-3,7-8H,4-5H2,1H3,(H,15,16) |
| InChIKey | LKMAXSNOWRDIPG-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.12 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |