C11H13NO5 — CID 66237142
4-[furan-2-carbonyl(methyl)amino]oxolane-3-carboxylic acid (PubChem CID 66237142) has the molecular formula C11H13NO5 and a molecular weight of 239.23 g/mol. Its IUPAC name is 4-[furan-2-carbonyl(methyl)amino]oxolane-3-carboxylic acid.
| Compound Name | 4-[furan-2-carbonyl(methyl)amino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 66237142 |
| Molecular Formula | C11H13NO5 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 4-[furan-2-carbonyl(methyl)amino]oxolane-3-carboxylic acid |
| SMILES | CN(C(=O)c1ccco1)C1COCC1C(=O)O |
| InChI | InChI=1S/C11H13NO5/c1-12(10(13)9-3-2-4-17-9)8-6-16-5-7(8)11(14)15/h2-4,7-8H,5-6H2,1H3,(H,14,15) |
| InChIKey | ZRRSAZZGNFEYLH-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |