C18H24F2N2O — CID 134704174
N-[(3aS,6aR)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-2,4-difluoro-N-methylbenzamide (PubChem CID 134704174) has the molecular formula C18H24F2N2O and a molecular weight of 322.40 g/mol. Its IUPAC name is N-[(3aS,6aR)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-2,4-difluoro-N-methylbenzamide.
| Compound Name | N-[(3aS,6aR)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-2,4-difluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 134704174 |
| Molecular Formula | C18H24F2N2O |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | N-[(3aS,6aR)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-2,4-difluoro-N-methylbenzamide |
| SMILES | CN(C)C1C[C@@H]2CC(N(C)C(=O)c3ccc(F)cc3F)C[C@@H]2C1 |
| InChI | InChI=1S/C18H24F2N2O/c1-21(2)14-6-11-8-15(9-12(11)7-14)22(3)18(23)16-5-4-13(19)10-17(16)20/h4-5,10-12,14-15H,6-9H2,1-3H3/t11-,12+,14?,15? |
| InChIKey | NJAIPAODVFZAJJ-AVJIGQEQSA-N |
| XLogP | 3.16 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |