C19H26F2N2O2 — CID 134706613
N-[(3aS,6aR)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-2-(2,4-difluorophenoxy)-N-methylacetamide (PubChem CID 134706613) has the molecular formula C19H26F2N2O2 and a molecular weight of 352.43 g/mol. Its IUPAC name is N-[(3aS,6aR)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-2-(2,4-difluorophenoxy)-N-methylacetamide.
| Compound Name | N-[(3aS,6aR)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-2-(2,4-difluorophenoxy)-N-methylacetamide |
|---|---|
| PubChem CID | 134706613 |
| Molecular Formula | C19H26F2N2O2 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | N-[(3aS,6aR)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-2-(2,4-difluorophenoxy)-N-methylacetamide |
| SMILES | CN(C)C1C[C@@H]2CC(N(C)C(=O)COc3ccc(F)cc3F)C[C@@H]2C1 |
| InChI | InChI=1S/C19H26F2N2O2/c1-22(2)15-6-12-8-16(9-13(12)7-15)23(3)19(24)11-25-18-5-4-14(20)10-17(18)21/h4-5,10,12-13,15-16H,6-9,11H2,1-3H3/t12-,13+,15?,16? |
| InChIKey | KFZNCHBGMOMZSW-YPXDRJKUSA-N |
| XLogP | 2.92 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |