C16H22FNO — CID 112702414
4-fluoro-N,2-dimethyl-N-(3-methylcyclohexyl)benzamide (PubChem CID 112702414) has the molecular formula C16H22FNO and a molecular weight of 263.36 g/mol. Its IUPAC name is 4-fluoro-N,2-dimethyl-N-(3-methylcyclohexyl)benzamide.
| Compound Name | 4-fluoro-N,2-dimethyl-N-(3-methylcyclohexyl)benzamide |
|---|---|
| PubChem CID | 112702414 |
| Molecular Formula | C16H22FNO |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 4-fluoro-N,2-dimethyl-N-(3-methylcyclohexyl)benzamide |
| SMILES | Cc1cc(F)ccc1C(=O)N(C)C1CCCC(C)C1 |
| InChI | InChI=1S/C16H22FNO/c1-11-5-4-6-14(9-11)18(3)16(19)15-8-7-13(17)10-12(15)2/h7-8,10-11,14H,4-6,9H2,1-3H3 |
| InChIKey | QJDPFUSKLLUHRB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |