C14H18FNO2 — CID 113399934
4-fluoro-N,2-dimethyl-N-(2-methyloxolan-3-yl)benzamide (PubChem CID 113399934) has the molecular formula C14H18FNO2 and a molecular weight of 251.30 g/mol. Its IUPAC name is 4-fluoro-N,2-dimethyl-N-(2-methyloxolan-3-yl)benzamide.
| Compound Name | 4-fluoro-N,2-dimethyl-N-(2-methyloxolan-3-yl)benzamide |
|---|---|
| PubChem CID | 113399934 |
| Molecular Formula | C14H18FNO2 |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 4-fluoro-N,2-dimethyl-N-(2-methyloxolan-3-yl)benzamide |
| SMILES | Cc1cc(F)ccc1C(=O)N(C)C1CCOC1C |
| InChI | InChI=1S/C14H18FNO2/c1-9-8-11(15)4-5-12(9)14(17)16(3)13-6-7-18-10(13)2/h4-5,8,10,13H,6-7H2,1-3H3 |
| InChIKey | ZWLJYXAVFHBBAG-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |