C9H8Cl2FNO2 — CID 145439185
3,5-dichloro-4-fluoro-N-methoxy-N-methylbenzamide (PubChem CID 145439185) has the molecular formula C9H8Cl2FNO2 and a molecular weight of 252.07 g/mol. Its IUPAC name is 3,5-dichloro-4-fluoro-N-methoxy-N-methylbenzamide.
| Compound Name | 3,5-dichloro-4-fluoro-N-methoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 145439185 |
| Molecular Formula | C9H8Cl2FNO2 |
| Molecular Weight | 252.07 g/mol |
| Exact Mass | 250.99 |
| IUPAC Name | 3,5-dichloro-4-fluoro-N-methoxy-N-methylbenzamide |
| SMILES | CON(C)C(=O)c1cc(Cl)c(F)c(Cl)c1 |
| InChI | InChI=1S/C9H8Cl2FNO2/c1-13(15-2)9(14)5-3-6(10)8(12)7(11)4-5/h3-4H,1-2H3 |
| InChIKey | KMTAMRFWYPQBJC-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.07 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|