C11H15NO2 — CID 14973055
N-methoxy-N,3,4-trimethylbenzamide (PubChem CID 14973055) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is N-methoxy-N,3,4-trimethylbenzamide.
| Compound Name | N-methoxy-N,3,4-trimethylbenzamide |
|---|---|
| PubChem CID | 14973055 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | N-methoxy-N,3,4-trimethylbenzamide |
| SMILES | CON(C)C(=O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C11H15NO2/c1-8-5-6-10(7-9(8)2)11(13)12(3)14-4/h5-7H,1-4H3 |
| InChIKey | RYMVYOPMXHBGRI-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|