C10H14N2O2 — CID 43627456
3-amino-N-methoxy-N,4-dimethylbenzamide (PubChem CID 43627456) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 3-amino-N-methoxy-N,4-dimethylbenzamide.
| Compound Name | 3-amino-N-methoxy-N,4-dimethylbenzamide |
|---|---|
| PubChem CID | 43627456 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 3-amino-N-methoxy-N,4-dimethylbenzamide |
| SMILES | CON(C)C(=O)c1ccc(C)c(N)c1 |
| InChI | InChI=1S/C10H14N2O2/c1-7-4-5-8(6-9(7)11)10(13)12(2)14-3/h4-6H,11H2,1-3H3 |
| InChIKey | ISRZNHYXKNVHHF-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|