About N-methoxy-N,3-dimethyl-4-(trifluoromethyl)benzamide;3-methyl-4-(trifluoromethyl)benzoic acid
N-methoxy-N,3-dimethyl-4-(trifluoromethyl)benzamide;3-methyl-4-(trifluoromethyl)benzoic acid (PubChem CID 159162955) has the molecular formula C20H19F6NO4
and a molecular weight of 451.36 g/mol. Its IUPAC name is N-methoxy-N,3-dimethyl-4-(trifluoromethyl)benzamide;3-methyl-4-(trifluoromethyl)benzoic acid.
Molecular Properties
| Compound Name | N-methoxy-N,3-dimethyl-4-(trifluoromethyl)benzamide;3-methyl-4-(trifluoromethyl)benzoic acid |
| PubChem CID | 159162955 |
| Molecular Formula | C20H19F6NO4 |
| Molecular Weight | 451.36 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | N-methoxy-N,3-dimethyl-4-(trifluoromethyl)benzamide;3-methyl-4-(trifluoromethyl)benzoic acid |
| SMILES | CON(C)C(=O)c1ccc(C(F)(F)F)c(C)c1.Cc1cc(C(=O)O)ccc1C(F)(F)F |
| InChI | InChI=1S/C11H12F3NO2.C9H7F3O2/c1-7-6-8(10(16)15(2)17-3)4-5-9(7)11(12,13)14;1-5-4-6(8(13)14)2-3-7(5)9(10,11)12/h4-6H,1-3H3;2-4H,1H3,(H,13,14) |
| InChIKey | KKSNDLQUYOWIDW-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 451.36 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methoxy-N,3-dimethyl-4-(trifluoromethyl)benzamide;3-methyl-4-(trifluoromethyl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methoxy-N,3-dimethyl-4-(trifluoromethyl)benzamide;3-methyl-4-(trifluoromethyl)benzoic acid?
The IUPAC name of N-methoxy-N,3-dimethyl-4-(trifluoromethyl)benzamide;3-methyl-4-(trifluoromethyl)benzoic acid (CID 159162955) is N-methoxy-N,3-dimethyl-4-(trifluoromethyl)benzamide;3-methyl-4-(trifluoromethyl)benzoic acid.
What is the SMILES notation for N-methoxy-N,3-dimethyl-4-(trifluoromethyl)benzamide;3-methyl-4-(trifluoromethyl)benzoic acid?
The canonical SMILES for N-methoxy-N,3-dimethyl-4-(trifluoromethyl)benzamide;3-methyl-4-(trifluoromethyl)benzoic acid is CON(C)C(=O)c1ccc(C(F)(F)F)c(C)c1.Cc1cc(C(=O)O)ccc1C(F)(F)F.
What is the InChIKey of N-methoxy-N,3-dimethyl-4-(trifluoromethyl)benzamide;3-methyl-4-(trifluoromethyl)benzoic acid?
The InChIKey is KKSNDLQUYOWIDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F3NO2.C9H7F3O2/c1-7-6-8(10(16)15(2)17-3)4-5-9(7)11(12,13)14;1-5-4-6(8(13)14)2-3-7(5)9(10,11)12/h4-6H,1-3H3;2-4H,1H3,(H,13,14).
What are the key properties of N-methoxy-N,3-dimethyl-4-(trifluoromethyl)benzamide;3-methyl-4-(trifluoromethyl)benzoic acid?
N-methoxy-N,3-dimethyl-4-(trifluoromethyl)benzamide;3-methyl-4-(trifluoromethyl)benzoic acid has a molecular weight of 451.36 g/mol, XLogP of 5.36, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methoxy-N,3-dimethyl-4-(trifluoromethyl)benzamide;3-methyl-4-(trifluoromethyl)benzoic acid is sourced from PubChem (CID 159162955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).