C75H81NO18 — CID 159771218
3-acetyl-N-methoxy-N,5-dimethylbenzamide;tris(3-acetyl-5-methylbenzoic acid);tris(1-(3-acetyl-5-methylphenyl)ethanone) (PubChem CID 159771218) has the molecular formula C75H81NO18 and a molecular weight of 1284.46 g/mol. Its IUPAC name is 3-acetyl-N-methoxy-N,5-dimethylbenzamide;tris(3-acetyl-5-methylbenzoic acid);tris(1-(3-acetyl-5-methylphenyl)ethanone).
| Compound Name | 3-acetyl-N-methoxy-N,5-dimethylbenzamide;tris(3-acetyl-5-methylbenzoic acid);tris(1-(3-acetyl-5-methylphenyl)ethanone) |
|---|---|
| PubChem CID | 159771218 |
| Molecular Formula | C75H81NO18 |
| Molecular Weight | 1284.46 g/mol |
| Exact Mass | 1283.55 |
| IUPAC Name | 3-acetyl-N-methoxy-N,5-dimethylbenzamide;tris(3-acetyl-5-methylbenzoic acid);tris(1-(3-acetyl-5-methylphenyl)ethanone) |
| SMILES | CC(=O)c1cc(C)cc(C(=O)O)c1.CC(=O)c1cc(C)cc(C(=O)O)c1.CC(=O)c1cc(C)cc(C(=O)O)c1.CC(=O)c1cc(C)cc(C(C)=O)c1.CC(=O)c1cc(C)cc(C(C)=O)c1.CC(=O)c1cc(C)cc(C(C)=O)c1.CON(C)C(=O)c1cc(C)cc(C(C)=O)c1 |
| InChI | InChI=1S/C12H15NO3.3C11H12O2.3C10H10O3/c1-8-5-10(9(2)14)7-11(6-8)12(15)13(3)16-4;3*1-7-4-10(8(2)12)6-11(5-7)9(3)13;3*1-6-3-8(7(2)11)5-9(4-6)10(12)13/h5-7H,1-4H3;3*4-6H,1-3H3;3*3-5H,1-2H3,(H,12,13) |
| InChIKey | NGDFPJLSMNOUHF-UHFFFAOYSA-N |
| XLogP | 14.72 |
| TPSA | 312.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 94 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1284.46 |
| LogP ≤ 5 | 14.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|