About ethane;4-fluoro-N-methoxy-N-methylbenzamide;methanethiol
ethane;4-fluoro-N-methoxy-N-methylbenzamide;methanethiol (PubChem CID 143189438) has the molecular formula C12H20FNO2S
and a molecular weight of 261.36 g/mol. Its IUPAC name is ethane;4-fluoro-N-methoxy-N-methylbenzamide;methanethiol.
Molecular Properties
| Compound Name | ethane;4-fluoro-N-methoxy-N-methylbenzamide;methanethiol |
| PubChem CID | 143189438 |
| Molecular Formula | C12H20FNO2S |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | ethane;4-fluoro-N-methoxy-N-methylbenzamide;methanethiol |
| SMILES | CC.CON(C)C(=O)c1ccc(F)cc1.CS |
| InChI | InChI=1S/C9H10FNO2.C2H6.CH4S/c1-11(13-2)9(12)7-3-5-8(10)6-4-7;2*1-2/h3-6H,1-2H3;1-2H3;2H,1H3 |
| InChIKey | HDJLJDIVXOVUEZ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 29.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;4-fluoro-N-methoxy-N-methylbenzamide;methanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-fluoro-N-methoxy-N-methylbenzamide;methanethiol?
The IUPAC name of ethane;4-fluoro-N-methoxy-N-methylbenzamide;methanethiol (CID 143189438) is ethane;4-fluoro-N-methoxy-N-methylbenzamide;methanethiol.
What is the SMILES notation for ethane;4-fluoro-N-methoxy-N-methylbenzamide;methanethiol?
The canonical SMILES for ethane;4-fluoro-N-methoxy-N-methylbenzamide;methanethiol is CC.CON(C)C(=O)c1ccc(F)cc1.CS.
What is the InChIKey of ethane;4-fluoro-N-methoxy-N-methylbenzamide;methanethiol?
The InChIKey is HDJLJDIVXOVUEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10FNO2.C2H6.CH4S/c1-11(13-2)9(12)7-3-5-8(10)6-4-7;2*1-2/h3-6H,1-2H3;1-2H3;2H,1H3.
What are the key properties of ethane;4-fluoro-N-methoxy-N-methylbenzamide;methanethiol?
ethane;4-fluoro-N-methoxy-N-methylbenzamide;methanethiol has a molecular weight of 261.36 g/mol, XLogP of 3.03, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-fluoro-N-methoxy-N-methylbenzamide;methanethiol is sourced from PubChem (CID 143189438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).