C12H15F5N2O3S — CID 58137450
5-acetamido-N-methoxy-N,2-dimethyl-4-(pentafluoro-λ6-sulfanyl)benzamide (PubChem CID 58137450) has the molecular formula C12H15F5N2O3S and a molecular weight of 362.32 g/mol. Its IUPAC name is 5-acetamido-N-methoxy-N,2-dimethyl-4-(pentafluoro-λ6-sulfanyl)benzamide.
| Compound Name | 5-acetamido-N-methoxy-N,2-dimethyl-4-(pentafluoro-λ6-sulfanyl)benzamide |
|---|---|
| PubChem CID | 58137450 |
| Molecular Formula | C12H15F5N2O3S |
| Molecular Weight | 362.32 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 5-acetamido-N-methoxy-N,2-dimethyl-4-(pentafluoro-λ6-sulfanyl)benzamide |
| SMILES | CON(C)C(=O)c1cc(NC(C)=O)c(S(F)(F)(F)(F)F)cc1C |
| InChI | InChI=1S/C12H15F5N2O3S/c1-7-5-11(23(13,14,15,16)17)10(18-8(2)20)6-9(7)12(21)19(3)22-4/h5-6H,1-4H3,(H,18,20) |
| InChIKey | DXPKNZLUNRDWCT-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.32 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|