C9H8BrF2NO2 — CID 171366673
4-bromo-2,3-difluoro-N-methoxy-N-methylbenzamide (PubChem CID 171366673) has the molecular formula C9H8BrF2NO2 and a molecular weight of 280.07 g/mol. Its IUPAC name is 4-bromo-2,3-difluoro-N-methoxy-N-methylbenzamide.
| Compound Name | 4-bromo-2,3-difluoro-N-methoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 171366673 |
| Molecular Formula | C9H8BrF2NO2 |
| Molecular Weight | 280.07 g/mol |
| Exact Mass | 278.97 |
| IUPAC Name | 4-bromo-2,3-difluoro-N-methoxy-N-methylbenzamide |
| SMILES | CON(C)C(=O)c1ccc(Br)c(F)c1F |
| InChI | InChI=1S/C9H8BrF2NO2/c1-13(15-2)9(14)5-3-4-6(10)8(12)7(5)11/h3-4H,1-2H3 |
| InChIKey | BURFEVVOHSFQKQ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.07 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|