C9H11NO4 — CID 114344880
2,3-dihydroxy-N-methoxy-N-methylbenzamide (PubChem CID 114344880) has the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. Its IUPAC name is 2,3-dihydroxy-N-methoxy-N-methylbenzamide.
| Compound Name | 2,3-dihydroxy-N-methoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 114344880 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 2,3-dihydroxy-N-methoxy-N-methylbenzamide |
| SMILES | CON(C)C(=O)c1cccc(O)c1O |
| InChI | InChI=1S/C9H11NO4/c1-10(14-2)9(13)6-4-3-5-7(11)8(6)12/h3-5,11-12H,1-2H3 |
| InChIKey | VMBGTKDYIPWHGQ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|