C8H10N2O3 — CID 142945868
2,3-dihydroxy-N-methylbenzohydrazide (PubChem CID 142945868) has the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. Its IUPAC name is 2,3-dihydroxy-N-methylbenzohydrazide.
| Compound Name | 2,3-dihydroxy-N-methylbenzohydrazide |
|---|---|
| PubChem CID | 142945868 |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | 2,3-dihydroxy-N-methylbenzohydrazide |
| SMILES | CN(N)C(=O)c1cccc(O)c1O |
| InChI | InChI=1S/C8H10N2O3/c1-10(9)8(13)5-3-2-4-6(11)7(5)12/h2-4,11-12H,9H2,1H3 |
| InChIKey | HZZOCYRTZJMMKV-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|