About 2,3-dihydroxybenzoyl bromide
2,3-dihydroxybenzoyl bromide (PubChem CID 141115203) has the molecular formula C7H5BrO3
and a molecular weight of 217.02 g/mol. Its IUPAC name is 2,3-dihydroxybenzoyl bromide.
Molecular Properties
| Compound Name | 2,3-dihydroxybenzoyl bromide |
| PubChem CID | 141115203 |
| Molecular Formula | C7H5BrO3 |
| Molecular Weight | 217.02 g/mol |
| Exact Mass | 215.94 |
| IUPAC Name | 2,3-dihydroxybenzoyl bromide |
| SMILES | O=C(Br)c1cccc(O)c1O |
| InChI | InChI=1S/C7H5BrO3/c8-7(11)4-2-1-3-5(9)6(4)10/h1-3,9-10H |
| InChIKey | UTHWMKPZAXIQLQ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.02 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dihydroxybenzoyl bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydroxybenzoyl bromide?
The IUPAC name of 2,3-dihydroxybenzoyl bromide (CID 141115203) is 2,3-dihydroxybenzoyl bromide.
What is the SMILES notation for 2,3-dihydroxybenzoyl bromide?
The canonical SMILES for 2,3-dihydroxybenzoyl bromide is O=C(Br)c1cccc(O)c1O.
What is the InChIKey of 2,3-dihydroxybenzoyl bromide?
The InChIKey is UTHWMKPZAXIQLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BrO3/c8-7(11)4-2-1-3-5(9)6(4)10/h1-3,9-10H.
What are the key properties of 2,3-dihydroxybenzoyl bromide?
2,3-dihydroxybenzoyl bromide has a molecular weight of 217.02 g/mol, XLogP of 1.63, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroxybenzoyl bromide is sourced from PubChem (CID 141115203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).