C12H14BrNO3 — CID 114345330
N-[[1-(bromomethyl)cyclopropyl]methyl]-2,3-dihydroxybenzamide (PubChem CID 114345330) has the molecular formula C12H14BrNO3 and a molecular weight of 300.15 g/mol. Its IUPAC name is N-[[1-(bromomethyl)cyclopropyl]methyl]-2,3-dihydroxybenzamide.
| Compound Name | N-[[1-(bromomethyl)cyclopropyl]methyl]-2,3-dihydroxybenzamide |
|---|---|
| PubChem CID | 114345330 |
| Molecular Formula | C12H14BrNO3 |
| Molecular Weight | 300.15 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | N-[[1-(bromomethyl)cyclopropyl]methyl]-2,3-dihydroxybenzamide |
| SMILES | O=C(NCC1(CBr)CC1)c1cccc(O)c1O |
| InChI | InChI=1S/C12H14BrNO3/c13-6-12(4-5-12)7-14-11(17)8-2-1-3-9(15)10(8)16/h1-3,15-16H,4-7H2,(H,14,17) |
| InChIKey | BGKMRVGBDXAEIG-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.15 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|