C16H18BrN3O — CID 104615776
N-[[1-(bromomethyl)cyclopentyl]methyl]quinoxaline-5-carboxamide (PubChem CID 104615776) has the molecular formula C16H18BrN3O and a molecular weight of 348.24 g/mol. Its IUPAC name is N-[[1-(bromomethyl)cyclopentyl]methyl]quinoxaline-5-carboxamide.
| Compound Name | N-[[1-(bromomethyl)cyclopentyl]methyl]quinoxaline-5-carboxamide |
|---|---|
| PubChem CID | 104615776 |
| Molecular Formula | C16H18BrN3O |
| Molecular Weight | 348.24 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | N-[[1-(bromomethyl)cyclopentyl]methyl]quinoxaline-5-carboxamide |
| SMILES | O=C(NCC1(CBr)CCCC1)c1cccc2nccnc12 |
| InChI | InChI=1S/C16H18BrN3O/c17-10-16(6-1-2-7-16)11-20-15(21)12-4-3-5-13-14(12)19-9-8-18-13/h3-5,8-9H,1-2,6-7,10-11H2,(H,20,21) |
| InChIKey | UIEPIDYWAHMZAG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.24 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|