C15H20BrNO2 — CID 82830831
N-[[1-(bromomethyl)cyclopentyl]methyl]-3-hydroxy-2-methylbenzamide (PubChem CID 82830831) has the molecular formula C15H20BrNO2 and a molecular weight of 326.23 g/mol. Its IUPAC name is N-[[1-(bromomethyl)cyclopentyl]methyl]-3-hydroxy-2-methylbenzamide.
| Compound Name | N-[[1-(bromomethyl)cyclopentyl]methyl]-3-hydroxy-2-methylbenzamide |
|---|---|
| PubChem CID | 82830831 |
| Molecular Formula | C15H20BrNO2 |
| Molecular Weight | 326.23 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | N-[[1-(bromomethyl)cyclopentyl]methyl]-3-hydroxy-2-methylbenzamide |
| SMILES | Cc1c(O)cccc1C(=O)NCC1(CBr)CCCC1 |
| InChI | InChI=1S/C15H20BrNO2/c1-11-12(5-4-6-13(11)18)14(19)17-10-15(9-16)7-2-3-8-15/h4-6,18H,2-3,7-10H2,1H3,(H,17,19) |
| InChIKey | HRABYAALFFZXPB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.23 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|