C15H22BrN3O — CID 104672795
N-[[1-(bromomethyl)cyclohexyl]methyl]-3,6-dimethylpyridazine-4-carboxamide (PubChem CID 104672795) has the molecular formula C15H22BrN3O and a molecular weight of 340.27 g/mol. Its IUPAC name is N-[[1-(bromomethyl)cyclohexyl]methyl]-3,6-dimethylpyridazine-4-carboxamide.
| Compound Name | N-[[1-(bromomethyl)cyclohexyl]methyl]-3,6-dimethylpyridazine-4-carboxamide |
|---|---|
| PubChem CID | 104672795 |
| Molecular Formula | C15H22BrN3O |
| Molecular Weight | 340.27 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | N-[[1-(bromomethyl)cyclohexyl]methyl]-3,6-dimethylpyridazine-4-carboxamide |
| SMILES | Cc1cc(C(=O)NCC2(CBr)CCCCC2)c(C)nn1 |
| InChI | InChI=1S/C15H22BrN3O/c1-11-8-13(12(2)19-18-11)14(20)17-10-15(9-16)6-4-3-5-7-15/h8H,3-7,9-10H2,1-2H3,(H,17,20) |
| InChIKey | RPHJOEVPCCILIE-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.27 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|