C15H18Br3NO — CID 107941343
2,4-dibromo-N-[[1-(bromomethyl)cyclohexyl]methyl]benzamide (PubChem CID 107941343) has the molecular formula C15H18Br3NO and a molecular weight of 468.03 g/mol. Its IUPAC name is 2,4-dibromo-N-[[1-(bromomethyl)cyclohexyl]methyl]benzamide.
| Compound Name | 2,4-dibromo-N-[[1-(bromomethyl)cyclohexyl]methyl]benzamide |
|---|---|
| PubChem CID | 107941343 |
| Molecular Formula | C15H18Br3NO |
| Molecular Weight | 468.03 g/mol |
| Exact Mass | 464.89 |
| IUPAC Name | 2,4-dibromo-N-[[1-(bromomethyl)cyclohexyl]methyl]benzamide |
| SMILES | O=C(NCC1(CBr)CCCCC1)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C15H18Br3NO/c16-9-15(6-2-1-3-7-15)10-19-14(20)12-5-4-11(17)8-13(12)18/h4-5,8H,1-3,6-7,9-10H2,(H,19,20) |
| InChIKey | IUQOMCBLUMMROL-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.03 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|