C12H12Br3NO — CID 107941451
2,4-dibromo-N-[1-(bromomethyl)cyclobutyl]benzamide (PubChem CID 107941451) has the molecular formula C12H12Br3NO and a molecular weight of 425.95 g/mol. Its IUPAC name is 2,4-dibromo-N-[1-(bromomethyl)cyclobutyl]benzamide.
| Compound Name | 2,4-dibromo-N-[1-(bromomethyl)cyclobutyl]benzamide |
|---|---|
| PubChem CID | 107941451 |
| Molecular Formula | C12H12Br3NO |
| Molecular Weight | 425.95 g/mol |
| Exact Mass | 422.85 |
| IUPAC Name | 2,4-dibromo-N-[1-(bromomethyl)cyclobutyl]benzamide |
| SMILES | O=C(NC1(CBr)CCC1)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C12H12Br3NO/c13-7-12(4-1-5-12)16-11(17)9-3-2-8(14)6-10(9)15/h2-3,6H,1,4-5,7H2,(H,16,17) |
| InChIKey | FLJMEMLYWQOZKG-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.95 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|