C13H15Br2NO2 — CID 113356722
2,4-dibromo-N-[1-(hydroxymethyl)cyclopentyl]benzamide (PubChem CID 113356722) has the molecular formula C13H15Br2NO2 and a molecular weight of 377.08 g/mol. Its IUPAC name is 2,4-dibromo-N-[1-(hydroxymethyl)cyclopentyl]benzamide.
| Compound Name | 2,4-dibromo-N-[1-(hydroxymethyl)cyclopentyl]benzamide |
|---|---|
| PubChem CID | 113356722 |
| Molecular Formula | C13H15Br2NO2 |
| Molecular Weight | 377.08 g/mol |
| Exact Mass | 374.95 |
| IUPAC Name | 2,4-dibromo-N-[1-(hydroxymethyl)cyclopentyl]benzamide |
| SMILES | O=C(NC1(CO)CCCC1)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C13H15Br2NO2/c14-9-3-4-10(11(15)7-9)12(18)16-13(8-17)5-1-2-6-13/h3-4,7,17H,1-2,5-6,8H2,(H,16,18) |
| InChIKey | XRULQRBGPSXYAJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.08 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |