C14H16Br3NO — CID 107975182
3,5-dibromo-N-[[1-(bromomethyl)cyclopentyl]methyl]benzamide (PubChem CID 107975182) has the molecular formula C14H16Br3NO and a molecular weight of 454.00 g/mol. Its IUPAC name is 3,5-dibromo-N-[[1-(bromomethyl)cyclopentyl]methyl]benzamide.
| Compound Name | 3,5-dibromo-N-[[1-(bromomethyl)cyclopentyl]methyl]benzamide |
|---|---|
| PubChem CID | 107975182 |
| Molecular Formula | C14H16Br3NO |
| Molecular Weight | 454.00 g/mol |
| Exact Mass | 450.88 |
| IUPAC Name | 3,5-dibromo-N-[[1-(bromomethyl)cyclopentyl]methyl]benzamide |
| SMILES | O=C(NCC1(CBr)CCCC1)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C14H16Br3NO/c15-8-14(3-1-2-4-14)9-18-13(19)10-5-11(16)7-12(17)6-10/h5-7H,1-4,8-9H2,(H,18,19) |
| InChIKey | PPTRIPRAQIUTOL-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.00 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|