C15H18Br2FNO — CID 103969816
4-bromo-N-[[1-(bromomethyl)cyclohexyl]methyl]-3-fluorobenzamide (PubChem CID 103969816) has the molecular formula C15H18Br2FNO and a molecular weight of 407.12 g/mol. Its IUPAC name is 4-bromo-N-[[1-(bromomethyl)cyclohexyl]methyl]-3-fluorobenzamide.
| Compound Name | 4-bromo-N-[[1-(bromomethyl)cyclohexyl]methyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 103969816 |
| Molecular Formula | C15H18Br2FNO |
| Molecular Weight | 407.12 g/mol |
| Exact Mass | 404.97 |
| IUPAC Name | 4-bromo-N-[[1-(bromomethyl)cyclohexyl]methyl]-3-fluorobenzamide |
| SMILES | O=C(NCC1(CBr)CCCCC1)c1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C15H18Br2FNO/c16-9-15(6-2-1-3-7-15)10-19-14(20)11-4-5-12(17)13(18)8-11/h4-5,8H,1-3,6-7,9-10H2,(H,19,20) |
| InChIKey | UEOYSXHVDZYOKE-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.12 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|