C18H26BrNO — CID 103969744
N-[[1-(bromomethyl)cyclohexyl]methyl]-4-propan-2-ylbenzamide (PubChem CID 103969744) has the molecular formula C18H26BrNO and a molecular weight of 352.32 g/mol. Its IUPAC name is N-[[1-(bromomethyl)cyclohexyl]methyl]-4-propan-2-ylbenzamide.
| Compound Name | N-[[1-(bromomethyl)cyclohexyl]methyl]-4-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 103969744 |
| Molecular Formula | C18H26BrNO |
| Molecular Weight | 352.32 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | N-[[1-(bromomethyl)cyclohexyl]methyl]-4-propan-2-ylbenzamide |
| SMILES | CC(C)c1ccc(C(=O)NCC2(CBr)CCCCC2)cc1 |
| InChI | InChI=1S/C18H26BrNO/c1-14(2)15-6-8-16(9-7-15)17(21)20-13-18(12-19)10-4-3-5-11-18/h6-9,14H,3-5,10-13H2,1-2H3,(H,20,21) |
| InChIKey | BHXOWTLNAXGSTL-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.32 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|