C15H18Br2ClNO — CID 107941344
3-bromo-N-[[1-(bromomethyl)cyclohexyl]methyl]-5-chlorobenzamide (PubChem CID 107941344) has the molecular formula C15H18Br2ClNO and a molecular weight of 423.58 g/mol. Its IUPAC name is 3-bromo-N-[[1-(bromomethyl)cyclohexyl]methyl]-5-chlorobenzamide.
| Compound Name | 3-bromo-N-[[1-(bromomethyl)cyclohexyl]methyl]-5-chlorobenzamide |
|---|---|
| PubChem CID | 107941344 |
| Molecular Formula | C15H18Br2ClNO |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 420.94 |
| IUPAC Name | 3-bromo-N-[[1-(bromomethyl)cyclohexyl]methyl]-5-chlorobenzamide |
| SMILES | O=C(NCC1(CBr)CCCCC1)c1cc(Cl)cc(Br)c1 |
| InChI | InChI=1S/C15H18Br2ClNO/c16-9-15(4-2-1-3-5-15)10-19-14(20)11-6-12(17)8-13(18)7-11/h6-8H,1-5,9-10H2,(H,19,20) |
| InChIKey | BHKHVLGUZDXORS-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|